C10H13N3S — CID 89179213
(1Z,3Z)-1-(5-methyl-1,3-thiazol-2-yl)hexa-1,3,5-triene-1,5-diamine (PubChem CID 89179213) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is (1Z,3Z)-1-(5-methyl-1,3-thiazol-2-yl)hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3Z)-1-(5-methyl-1,3-thiazol-2-yl)hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 89179213 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (1Z,3Z)-1-(5-methyl-1,3-thiazol-2-yl)hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(N)/C=C\C=C(/N)c1ncc(C)s1 |
| InChI | InChI=1S/C10H13N3S/c1-7(11)4-3-5-9(12)10-13-6-8(2)14-10/h3-6H,1,11-12H2,2H3/b4-3-,9-5- |
| InChIKey | OUFMFCGYQRFSMQ-YSXYLNKBSA-N |
| XLogP | 1.78 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|