2-hydroxy-1,2-dihydropyridine-3-carboxylic acid

C6H7NO3 — CID 89179457

IUPAC2-hydroxy-1,2-dihydropyridine-3-carboxylic acid
SMILESO=C(O)C1=CC=CNC1O
InChIInChI=1S/C6H7NO3/c8-5-4(6(9)10)2-1-3-7-5/h1-3,5,7-8H,(H,9,10)
InChIKeyOJQDLACCXYZYEA-UHFFFAOYSA-N
MW141.13 g/mol
LogP-0.57
Rot. Bonds1

About 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid

2-hydroxy-1,2-dihydropyridine-3-carboxylic acid (PubChem CID 89179457) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-hydroxy-1,2-dihydropyridine-3-carboxylic acid
PubChem CID89179457
Molecular FormulaC6H7NO3
Molecular Weight141.13 g/mol
Exact Mass141.04
IUPAC Name2-hydroxy-1,2-dihydropyridine-3-carboxylic acid
SMILESO=C(O)C1=CC=CNC1O
InChIInChI=1S/C6H7NO3/c8-5-4(6(9)10)2-1-3-7-5/h1-3,5,7-8H,(H,9,10)
InChIKeyOJQDLACCXYZYEA-UHFFFAOYSA-N
XLogP-0.57
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 5-0.57
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid?
The IUPAC name of 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid (CID 89179457) is 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid.
What is the SMILES notation for 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid?
The canonical SMILES for 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid is O=C(O)C1=CC=CNC1O.
What is the InChIKey of 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid?
The InChIKey is OJQDLACCXYZYEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-5-4(6(9)10)2-1-3-7-5/h1-3,5,7-8H,(H,9,10).
What are the key properties of 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid?
2-hydroxy-1,2-dihydropyridine-3-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of -0.57, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,2-dihydropyridine-3-carboxylic acid is sourced from PubChem (CID 89179457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).