C15H24N2O2 — CID 89180086
(7E)-3-(2-amino-3-nitrosobut-3-enyl)-7-methyldeca-1,7,9-trien-2-ol (PubChem CID 89180086) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (7E)-3-(2-amino-3-nitrosobut-3-enyl)-7-methyldeca-1,7,9-trien-2-ol.
| Compound Name | (7E)-3-(2-amino-3-nitrosobut-3-enyl)-7-methyldeca-1,7,9-trien-2-ol |
|---|---|
| PubChem CID | 89180086 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (7E)-3-(2-amino-3-nitrosobut-3-enyl)-7-methyldeca-1,7,9-trien-2-ol |
| SMILES | C=C/C=C(\C)CCCC(CC(N)C(=C)N=O)C(=C)O |
| InChI | InChI=1S/C15H24N2O2/c1-5-7-11(2)8-6-9-14(13(4)18)10-15(16)12(3)17-19/h5,7,14-15,18H,1,3-4,6,8-10,16H2,2H3/b11-7+ |
| InChIKey | RJWABJVCKXKADR-YRNVUSSQSA-N |
| XLogP | 3.97 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|