C18H18BrN3O3 — CID 89180129
tert-butyl 8-(bromomethyl)-3-oxo-6-phenyl-[1,2,4]triazolo[4,3-a]pyridine-2-carboxylate (PubChem CID 89180129) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is tert-butyl 8-(bromomethyl)-3-oxo-6-phenyl-[1,2,4]triazolo[4,3-a]pyridine-2-carboxylate.
| Compound Name | tert-butyl 8-(bromomethyl)-3-oxo-6-phenyl-[1,2,4]triazolo[4,3-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 89180129 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | tert-butyl 8-(bromomethyl)-3-oxo-6-phenyl-[1,2,4]triazolo[4,3-a]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc2c(CBr)cc(-c3ccccc3)cn2c1=O |
| InChI | InChI=1S/C18H18BrN3O3/c1-18(2,3)25-17(24)22-16(23)21-11-14(12-7-5-4-6-8-12)9-13(10-19)15(21)20-22/h4-9,11H,10H2,1-3H3 |
| InChIKey | MLEPRVAIDPBYBC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|