About CID 89180300
CID 89180300 (PubChem CID 89180300) has the molecular formula C17H15BF2N2O
and a molecular weight of 312.13 g/mol.
Molecular Properties
| Compound Name | CID 89180300 |
| PubChem CID | 89180300 |
| Molecular Formula | C17H15BF2N2O |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C2(c3ccc(OC(F)F)cc3)CCC(N)=N2)c1 |
| InChI | InChI=1S/C17H15BF2N2O/c18-13-3-1-2-12(10-13)17(9-8-15(21)22-17)11-4-6-14(7-5-11)23-16(19)20/h1-7,10,16H,8-9H2,(H2,21,22) |
| InChIKey | FFOJHOGWBIMQFR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89180300 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89180300?
The IUPAC name of CID 89180300 (CID 89180300) is not available.
What is the SMILES notation for CID 89180300?
The canonical SMILES for CID 89180300 is [B]c1cccc(C2(c3ccc(OC(F)F)cc3)CCC(N)=N2)c1.
What is the InChIKey of CID 89180300?
The InChIKey is FFOJHOGWBIMQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BF2N2O/c18-13-3-1-2-12(10-13)17(9-8-15(21)22-17)11-4-6-14(7-5-11)23-16(19)20/h1-7,10,16H,8-9H2,(H2,21,22).
What are the key properties of CID 89180300?
CID 89180300 has a molecular weight of 312.13 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89180300 is sourced from PubChem (CID 89180300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).