About (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole
(4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole (PubChem CID 89180329) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole |
| PubChem CID | 89180329 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole |
| SMILES | C=C/C=C(C)\C=C1\C=NNC1 |
| InChI | InChI=1S/C9H12N2/c1-3-4-8(2)5-9-6-10-11-7-9/h3-6,11H,1,7H2,2H3/b8-4-,9-5- |
| InChIKey | ISDVWLBVVVSPOC-XEQVNJCQSA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole?
The IUPAC name of (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole (CID 89180329) is (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole.
What is the SMILES notation for (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole?
The canonical SMILES for (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole is C=C/C=C(C)\C=C1\C=NNC1.
What is the InChIKey of (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole?
The InChIKey is ISDVWLBVVVSPOC-XEQVNJCQSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-4-8(2)5-9-6-10-11-7-9/h3-6,11H,1,7H2,2H3/b8-4-,9-5-.
What are the key properties of (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole?
(4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole has a molecular weight of 148.21 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(2Z)-2-methylpenta-2,4-dienylidene]-1,5-dihydropyrazole is sourced from PubChem (CID 89180329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).