About 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole
5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole (PubChem CID 89180396) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole |
| PubChem CID | 89180396 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole |
| SMILES | CC1=CC(c2ccn[nH]2)=C[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C11H12N2/c1-7-4-9(5-8-6-10(7)8)11-2-3-12-13-11/h2-5,8,10H,6H2,1H3,(H,12,13)/t8-,10-/m1/s1 |
| InChIKey | BIUYFHBVKKCFED-PSASIEDQSA-N |
| XLogP | 2.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole?
The IUPAC name of 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole (CID 89180396) is 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole.
What is the SMILES notation for 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole?
The canonical SMILES for 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole is CC1=CC(c2ccn[nH]2)=C[C@@H]2C[C@H]12.
What is the InChIKey of 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole?
The InChIKey is BIUYFHBVKKCFED-PSASIEDQSA-N. The full InChI is InChI=1S/C11H12N2/c1-7-4-9(5-8-6-10(7)8)11-2-3-12-13-11/h2-5,8,10H,6H2,1H3,(H,12,13)/t8-,10-/m1/s1.
What are the key properties of 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole?
5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole has a molecular weight of 172.23 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,6S)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]-1H-pyrazole is sourced from PubChem (CID 89180396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).