C33H49NO4Si — CID 89180528
(2R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide (PubChem CID 89180528) has the molecular formula C33H49NO4Si and a molecular weight of 551.84 g/mol. Its IUPAC name is (2R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide.
| Compound Name | (2R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide |
|---|---|
| PubChem CID | 89180528 |
| Molecular Formula | C33H49NO4Si |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | (2R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide |
| SMILES | C=C1CC(CCCCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O[C@H]1CCCC[C@@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C33H49NO4Si/c1-26(32(35)34(5)37-6)17-13-14-23-31-27(2)25-28(38-31)18-15-16-24-33(3,4)39(36,29-19-9-7-10-20-29)30-21-11-8-12-22-30/h7-12,19-22,26,28,31,36H,2,13-18,23-25H2,1,3-6H3/t26-,28?,31+/m1/s1 |
| InChIKey | MIAJLWZSAFFCJW-OLCQBPQLSA-N |
| XLogP | 6.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|