C14H17NO4 — CID 89180593
(2,5-dioxopyrrolidin-1-yl) (1S,4E,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate (PubChem CID 89180593) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (1S,4E,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (1S,4E,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 89180593 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (1S,4E,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)C1[C@H]2CC/C=C\CC[C@@H]12 |
| InChI | InChI=1S/C14H17NO4/c16-11-7-8-12(17)15(11)19-14(18)13-9-5-3-1-2-4-6-10(9)13/h1-2,9-10,13H,3-8H2/b2-1-/t9-,10+,13? |
| InChIKey | RCAITCSOPLJJFL-PCJQFCQHSA-N |
| XLogP | 1.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|