C13H23BN2O — CID 89180885
[(2Z,4E)-5-(N,N'-dimethylcarbamimidoyl)-6-methylhepta-2,4,6-trien-3-yl]-ethylborinic acid (PubChem CID 89180885) has the molecular formula C13H23BN2O and a molecular weight of 234.15 g/mol. Its IUPAC name is [(2Z,4E)-5-(N,N'-dimethylcarbamimidoyl)-6-methylhepta-2,4,6-trien-3-yl]-ethylborinic acid.
| Compound Name | [(2Z,4E)-5-(N,N'-dimethylcarbamimidoyl)-6-methylhepta-2,4,6-trien-3-yl]-ethylborinic acid |
|---|---|
| PubChem CID | 89180885 |
| Molecular Formula | C13H23BN2O |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | [(2Z,4E)-5-(N,N'-dimethylcarbamimidoyl)-6-methylhepta-2,4,6-trien-3-yl]-ethylborinic acid |
| SMILES | C=C(C)C(=C/C(=C\C)B(O)CC)/C(=N/C)NC |
| InChI | InChI=1S/C13H23BN2O/c1-7-11(14(17)8-2)9-12(10(3)4)13(15-5)16-6/h7,9,17H,3,8H2,1-2,4-6H3,(H,15,16)/b11-7+,12-9+ |
| InChIKey | CTHLFXUXPZYGKJ-HNWKWBPYSA-N |
| XLogP | 2.23 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|