C13H19FO2 — CID 89180900
4-[(3Z,5Z)-3-fluoroocta-1,3,5-trien-4-yl]oxyoxane (PubChem CID 89180900) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 4-[(3Z,5Z)-3-fluoroocta-1,3,5-trien-4-yl]oxyoxane.
| Compound Name | 4-[(3Z,5Z)-3-fluoroocta-1,3,5-trien-4-yl]oxyoxane |
|---|---|
| PubChem CID | 89180900 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-[(3Z,5Z)-3-fluoroocta-1,3,5-trien-4-yl]oxyoxane |
| SMILES | C=C/C(F)=C(\C=C/CC)OC1CCOCC1 |
| InChI | InChI=1S/C13H19FO2/c1-3-5-6-13(12(14)4-2)16-11-7-9-15-10-8-11/h4-6,11H,2-3,7-10H2,1H3/b6-5-,13-12- |
| InChIKey | XPRJMLJDNJPAQM-JKHKTYJBSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|