C9H9F11O — CID 89181058
1,1,1,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)hexane (PubChem CID 89181058) has the molecular formula C9H9F11O and a molecular weight of 342.15 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)hexane.
| Compound Name | 1,1,1,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)hexane |
|---|---|
| PubChem CID | 89181058 |
| Molecular Formula | C9H9F11O |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)hexane |
| SMILES | CCCCC(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F11O/c1-2-3-4-5(10,7(13,14)15)21-9(19,20)6(11,12)8(16,17)18/h2-4H2,1H3 |
| InChIKey | GXZHYMDYNVJWSJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|