C13H10F18N2O — CID 89181140
1,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)urea (PubChem CID 89181140) has the molecular formula C13H10F18N2O and a molecular weight of 552.20 g/mol. Its IUPAC name is 1,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)urea.
| Compound Name | 1,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)urea |
|---|---|
| PubChem CID | 89181140 |
| Molecular Formula | C13H10F18N2O |
| Molecular Weight | 552.20 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 1,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)urea |
| SMILES | O=C(NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F18N2O/c14-6(15,8(18,19)10(22,23)12(26,27)28)1-3-32-5(34)33-4-2-7(16,17)9(20,21)11(24,25)13(29,30)31/h1-4H2,(H2,32,33,34) |
| InChIKey | VADOGTPGVHSCCT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.20 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|