C12H11F9N2O2S — CID 89181181
1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-propan-2-yl-2-sulfanylideneimidazolidine-4,5-dione (PubChem CID 89181181) has the molecular formula C12H11F9N2O2S and a molecular weight of 418.28 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-propan-2-yl-2-sulfanylideneimidazolidine-4,5-dione.
| Compound Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-propan-2-yl-2-sulfanylideneimidazolidine-4,5-dione |
|---|---|
| PubChem CID | 89181181 |
| Molecular Formula | C12H11F9N2O2S |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-propan-2-yl-2-sulfanylideneimidazolidine-4,5-dione |
| SMILES | CC(C)N1C(=O)C(=O)N(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1=S |
| InChI | InChI=1S/C12H11F9N2O2S/c1-5(2)23-7(25)6(24)22(8(23)26)4-3-9(13,14)10(15,16)11(17,18)12(19,20)21/h5H,3-4H2,1-2H3 |
| InChIKey | MKXBWBFNKMGALR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|