C11H13F11N2S — CID 89181184
1-propan-2-yl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiourea (PubChem CID 89181184) has the molecular formula C11H13F11N2S and a molecular weight of 414.28 g/mol. Its IUPAC name is 1-propan-2-yl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiourea.
| Compound Name | 1-propan-2-yl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiourea |
|---|---|
| PubChem CID | 89181184 |
| Molecular Formula | C11H13F11N2S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-propan-2-yl-3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiourea |
| SMILES | CC(C)NC(=S)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F11N2S/c1-5(2)24-6(25)23-4-3-7(12,13)8(14,15)9(16,17)10(18,19)11(20,21)22/h5H,3-4H2,1-2H3,(H2,23,24,25) |
| InChIKey | LPFSBIGQZAOPIV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|