C17H4F26N2O3 — CID 89181289
1,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazolidine-2,4,5-trione (PubChem CID 89181289) has the molecular formula C17H4F26N2O3 and a molecular weight of 778.18 g/mol. Its IUPAC name is 1,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazolidine-2,4,5-trione.
| Compound Name | 1,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 89181289 |
| Molecular Formula | C17H4F26N2O3 |
| Molecular Weight | 778.18 g/mol |
| Exact Mass | 777.98 |
| IUPAC Name | 1,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)N1CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H4F26N2O3/c18-6(19,8(22,23)10(26,27)12(30,31)14(34,35)16(38,39)40)1-44-3(46)4(47)45(5(44)48)2-7(20,21)9(24,25)11(28,29)13(32,33)15(36,37)17(41,42)43/h1-2H2 |
| InChIKey | SQMKZDKZIYFMCD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.18 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|