C9H15F5N2S — CID 89181291
1-(2,2-dimethylpropyl)-3-(2,2,3,3,3-pentafluoropropyl)thiourea (PubChem CID 89181291) has the molecular formula C9H15F5N2S and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-(2,2,3,3,3-pentafluoropropyl)thiourea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-(2,2,3,3,3-pentafluoropropyl)thiourea |
|---|---|
| PubChem CID | 89181291 |
| Molecular Formula | C9H15F5N2S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-(2,2,3,3,3-pentafluoropropyl)thiourea |
| SMILES | CC(C)(C)CNC(=S)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F5N2S/c1-7(2,3)4-15-6(17)16-5-8(10,11)9(12,13)14/h4-5H2,1-3H3,(H2,15,16,17) |
| InChIKey | LOYJJCSHYLSPNB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|