C33H53N3O6 — CID 89181371
(2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-4,5-dimethylheptanoyl]pyrrolidin-2-yl]-2-methyl-N-[(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylbutan-2-yl]propanamide (PubChem CID 89181371) has the molecular formula C33H53N3O6 and a molecular weight of 587.80 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-4,5-dimethylheptanoyl]pyrrolidin-2-yl]-2-methyl-N-[(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylbutan-2-yl]propanamide.
| Compound Name | (2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-4,5-dimethylheptanoyl]pyrrolidin-2-yl]-2-methyl-N-[(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 89181371 |
| Molecular Formula | C33H53N3O6 |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.39 |
| IUPAC Name | (2R,3R)-3-methoxy-3-[(2S)-1-[(3R,4S,5S)-3-methoxy-4,5-dimethylheptanoyl]pyrrolidin-2-yl]-2-methyl-N-[(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylbutan-2-yl]propanamide |
| SMILES | CC[C@H](C)[C@H](C)[C@@H](CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)N[C@H](C(=O)N1CCCCO1)C(C)c1ccccc1)OC |
| InChI | InChI=1S/C33H53N3O6/c1-8-22(2)23(3)28(40-6)21-29(37)35-18-14-17-27(35)31(41-7)25(5)32(38)34-30(24(4)26-15-10-9-11-16-26)33(39)36-19-12-13-20-42-36/h9-11,15-16,22-25,27-28,30-31H,8,12-14,17-21H2,1-7H3,(H,34,38)/t22-,23-,24?,25+,27-,28+,30-,31+/m0/s1 |
| InChIKey | ZHWXXUOFMSLEHU-PHOKBZSGSA-N |
| XLogP | 4.56 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |