C18H22F2O — CID 89181502
2-[4-(4-ethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]oxirane (PubChem CID 89181502) has the molecular formula C18H22F2O and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-[4-(4-ethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-(4-ethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 89181502 |
| Molecular Formula | C18H22F2O |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[4-(4-ethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]oxirane |
| SMILES | CCC1CCC2C(c3ccc(C4CO4)c(F)c3F)CCC12 |
| InChI | InChI=1S/C18H22F2O/c1-2-10-3-4-12-11(10)5-6-13(12)14-7-8-15(16-9-21-16)18(20)17(14)19/h7-8,10-13,16H,2-6,9H2,1H3 |
| InChIKey | LXMCFPHWLRKSCG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|