C25H25F3O — CID 89181506
2-[2,3-difluoro-4-[2-fluoro-4-(4-propyl-3,3a,4,5,6,6a-hexahydropentalen-1-yl)phenyl]phenyl]oxirane (PubChem CID 89181506) has the molecular formula C25H25F3O and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[2-fluoro-4-(4-propyl-3,3a,4,5,6,6a-hexahydropentalen-1-yl)phenyl]phenyl]oxirane.
| Compound Name | 2-[2,3-difluoro-4-[2-fluoro-4-(4-propyl-3,3a,4,5,6,6a-hexahydropentalen-1-yl)phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89181506 |
| Molecular Formula | C25H25F3O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[2,3-difluoro-4-[2-fluoro-4-(4-propyl-3,3a,4,5,6,6a-hexahydropentalen-1-yl)phenyl]phenyl]oxirane |
| SMILES | CCCC1CCC2C(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3)=CCC12 |
| InChI | InChI=1S/C25H25F3O/c1-2-3-14-4-6-18-16(14)8-9-17(18)15-5-7-19(22(26)12-15)20-10-11-21(23-13-29-23)25(28)24(20)27/h5,7,9-12,14,16,18,23H,2-4,6,8,13H2,1H3 |
| InChIKey | GSJCJKVMZRZFLJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|