C24H22F4O — CID 89181509
2-[4-[4-(4-ethenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane (PubChem CID 89181509) has the molecular formula C24H22F4O and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-[4-[4-(4-ethenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-(4-ethenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 89181509 |
| Molecular Formula | C24H22F4O |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[4-[4-(4-ethenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
| SMILES | C=CC1CCC2C(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CCC12 |
| InChI | InChI=1S/C24H22F4O/c1-2-12-3-4-14-13(12)5-6-15(14)16-7-8-17(22(26)21(16)25)18-9-10-19(20-11-29-20)24(28)23(18)27/h2,7-10,12-15,20H,1,3-6,11H2 |
| InChIKey | YRXXJBFIQJAAAX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|