About 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine
3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine (PubChem CID 89181527) has the molecular formula C41H23F6N
and a molecular weight of 643.63 g/mol. Its IUPAC name is 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine.
Molecular Properties
| Compound Name | 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine |
| PubChem CID | 89181527 |
| Molecular Formula | C41H23F6N |
| Molecular Weight | 643.63 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine |
| SMILES | FC(F)(F)c1cccc(-c2c3ccccc3c(-c3cccc(C(F)(F)F)c3)c3cc4c(cc23)c(-c2cccnc2)cc2ccccc24)c1 |
| InChI | InChI=1S/C41H23F6N/c42-40(43,44)28-12-5-9-25(18-28)38-31-15-3-4-16-32(31)39(26-10-6-13-29(19-26)41(45,46)47)37-22-35-33(27-11-7-17-48-23-27)20-24-8-1-2-14-30(24)34(35)21-36(37)38/h1-23H |
| InChIKey | BKAKFZHDFZTDPK-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.63 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine?
The IUPAC name of 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine (CID 89181527) is 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine.
What is the SMILES notation for 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine?
The canonical SMILES for 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine is FC(F)(F)c1cccc(-c2c3ccccc3c(-c3cccc(C(F)(F)F)c3)c3cc4c(cc23)c(-c2cccnc2)cc2ccccc24)c1.
What is the InChIKey of 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine?
The InChIKey is BKAKFZHDFZTDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H23F6N/c42-40(43,44)28-12-5-9-25(18-28)38-31-15-3-4-16-32(31)39(26-10-6-13-29(19-26)41(45,46)47)37-22-35-33(27-11-7-17-48-23-27)20-24-8-1-2-14-30(24)34(35)21-36(37)38/h1-23H.
What are the key properties of 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine?
3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine has a molecular weight of 643.63 g/mol, XLogP of 12.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[8,13-bis[3-(trifluoromethyl)phenyl]benzo[a]tetracen-6-yl]pyridine is sourced from PubChem (CID 89181527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).