About 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine
6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 89181683) has the molecular formula C8H10ClN5
and a molecular weight of 211.66 g/mol. Its IUPAC name is 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 89181683 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CN(C)c1nc(Cl)nc2c1cnn2C |
| InChI | InChI=1S/C8H10ClN5/c1-13(2)6-5-4-10-14(3)7(5)12-8(9)11-6/h4H,1-3H3 |
| InChIKey | CULOSJIDUSQQCS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine (CID 89181683) is 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine is CN(C)c1nc(Cl)nc2c1cnn2C.
What is the InChIKey of 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is CULOSJIDUSQQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN5/c1-13(2)6-5-4-10-14(3)7(5)12-8(9)11-6/h4H,1-3H3.
What are the key properties of 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine?
6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 211.66 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,N,1-trimethylpyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 89181683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).