About 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine
6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 89181687) has the molecular formula C7H8FN5
and a molecular weight of 181.17 g/mol. Its IUPAC name is 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 89181687 |
| Molecular Formula | C7H8FN5 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CNc1nc(F)nc2c1cnn2C |
| InChI | InChI=1S/C7H8FN5/c1-9-5-4-3-10-13(2)6(4)12-7(8)11-5/h3H,1-2H3,(H,9,11,12) |
| InChIKey | RYIVGMDYXIWRGH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine (CID 89181687) is 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine is CNc1nc(F)nc2c1cnn2C.
What is the InChIKey of 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is RYIVGMDYXIWRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN5/c1-9-5-4-3-10-13(2)6(4)12-7(8)11-5/h3H,1-2H3,(H,9,11,12).
What are the key properties of 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine?
6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 181.17 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,1-dimethylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 89181687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).