C11H14N6S — CID 89181740
5-(2,4-dimethyl-1,3-thiazole-5-carboximidoyl)-4-N-methylpyrimidine-4,6-diamine (PubChem CID 89181740) has the molecular formula C11H14N6S and a molecular weight of 262.34 g/mol. Its IUPAC name is 5-(2,4-dimethyl-1,3-thiazole-5-carboximidoyl)-4-N-methylpyrimidine-4,6-diamine.
| Compound Name | 5-(2,4-dimethyl-1,3-thiazole-5-carboximidoyl)-4-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 89181740 |
| Molecular Formula | C11H14N6S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-(2,4-dimethyl-1,3-thiazole-5-carboximidoyl)-4-N-methylpyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1sc(C)nc1C)c1c(N)ncnc1NC |
| InChI | InChI=1S/C11H14N6S/c1-5-9(18-6(2)17-5)8(12)7-10(13)15-4-16-11(7)14-3/h4,12H,1-3H3,(H3,13,14,15,16)/b12-8- |
| InChIKey | HMUPRVXGBFGQRR-WQLSENKSSA-N |
| XLogP | 1.59 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|