About [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate
[1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 89182033) has the molecular formula C18H14F3NO7S
and a molecular weight of 445.37 g/mol. Its IUPAC name is [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| PubChem CID | 89182033 |
| Molecular Formula | C18H14F3NO7S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2cccc3c(OCC4CCCO4)ccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H14F3NO7S/c19-18(20,21)30(25,26)29-22-16(23)12-5-1-4-11-14(28-9-10-3-2-8-27-10)7-6-13(15(11)12)17(22)24/h1,4-7,10H,2-3,8-9H2 |
| InChIKey | YUXAUMSTVXFZSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate?
The IUPAC name of [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (CID 89182033) is [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate is O=C1c2cccc3c(OCC4CCCO4)ccc(c23)C(=O)N1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate?
The InChIKey is YUXAUMSTVXFZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3NO7S/c19-18(20,21)30(25,26)29-22-16(23)12-5-1-4-11-14(28-9-10-3-2-8-27-10)7-6-13(15(11)12)17(22)24/h1,4-7,10H,2-3,8-9H2.
What are the key properties of [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate?
[1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate has a molecular weight of 445.37 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dioxo-6-(oxolan-2-ylmethoxy)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 89182033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).