About (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate
(6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate (PubChem CID 89182050) has the molecular formula C26H27NO5S2
and a molecular weight of 497.64 g/mol. Its IUPAC name is (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate.
Molecular Properties
| Compound Name | (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate |
| PubChem CID | 89182050 |
| Molecular Formula | C26H27NO5S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate |
| SMILES | CCCCCCCCSc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C26H27NO5S2/c1-2-3-4-5-6-10-18-33-23-17-16-22-24-20(23)14-11-15-21(24)25(28)27(26(22)29)32-34(30,31)19-12-8-7-9-13-19/h7-9,11-17H,2-6,10,18H2,1H3 |
| InChIKey | XAPOPYBAZYOHSP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate?
The IUPAC name of (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate (CID 89182050) is (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate.
What is the SMILES notation for (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate?
The canonical SMILES for (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate is CCCCCCCCSc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccccc1)C2=O.
What is the InChIKey of (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate?
The InChIKey is XAPOPYBAZYOHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO5S2/c1-2-3-4-5-6-10-18-33-23-17-16-22-24-20(23)14-11-15-21(24)25(28)27(26(22)29)32-34(30,31)19-12-8-7-9-13-19/h7-9,11-17H,2-6,10,18H2,1H3.
What are the key properties of (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate?
(6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate has a molecular weight of 497.64 g/mol, XLogP of 6.21, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) benzenesulfonate is sourced from PubChem (CID 89182050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).