C21H22F3NO5S2 — CID 89182061
(5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 89182061) has the molecular formula C21H22F3NO5S2 and a molecular weight of 489.54 g/mol. Its IUPAC name is (5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | (5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89182061 |
| Molecular Formula | C21H22F3NO5S2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | CCCCCCCCSc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C21H22F3NO5S2/c1-2-3-4-5-6-7-11-31-15-12-14-9-8-10-16-18(14)17(13-15)20(27)25(19(16)26)30-32(28,29)21(22,23)24/h8-10,12-13H,2-7,11H2,1H3 |
| InChIKey | AYPXQXHTACHUIB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|