C37H50S — CID 89182153
(9bR)-3-(3-ethyl-4-propylcyclohexa-1,3-dien-1-yl)-7-[4-[(Z)-5-methylhept-4-en-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,4a,5a,6,9b-hexahydrodibenzothiophene (PubChem CID 89182153) has the molecular formula C37H50S and a molecular weight of 526.87 g/mol. Its IUPAC name is (9bR)-3-(3-ethyl-4-propylcyclohexa-1,3-dien-1-yl)-7-[4-[(Z)-5-methylhept-4-en-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,4a,5a,6,9b-hexahydrodibenzothiophene.
| Compound Name | (9bR)-3-(3-ethyl-4-propylcyclohexa-1,3-dien-1-yl)-7-[4-[(Z)-5-methylhept-4-en-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,4a,5a,6,9b-hexahydrodibenzothiophene |
|---|---|
| PubChem CID | 89182153 |
| Molecular Formula | C37H50S |
| Molecular Weight | 526.87 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | (9bR)-3-(3-ethyl-4-propylcyclohexa-1,3-dien-1-yl)-7-[4-[(Z)-5-methylhept-4-en-2-yl]cyclohexa-1,3-dien-1-yl]-1,2,4a,5a,6,9b-hexahydrodibenzothiophene |
| SMILES | CCCC1=C(CC)C=C(C2=CC3SC4CC(C5=CC=C(C(C)C/C=C(/C)CC)CC5)=CC=C4[C@H]3CC2)CC1 |
| InChI | InChI=1S/C37H50S/c1-6-9-29-16-17-31(22-27(29)8-3)33-19-21-35-34-20-18-32(23-36(34)38-37(35)24-33)30-14-12-28(13-15-30)26(5)11-10-25(4)7-2/h10,12,14,18,20,22,24,26,35-37H,6-9,11,13,15-17,19,21,23H2,1-5H3/b25-10-/t26?,35-,36?,37?/m1/s1 |
| InChIKey | PHHSMCCPRMJHEI-FXQYJRTBSA-N |
| XLogP | 11.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.87 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|