C24H40O5SSi — CID 89182203
2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyloxolan-2-yl]acetaldehyde (PubChem CID 89182203) has the molecular formula C24H40O5SSi and a molecular weight of 468.73 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyloxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyloxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 89182203 |
| Molecular Formula | C24H40O5SSi |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyloxolan-2-yl]acetaldehyde |
| SMILES | CC[C@H](C[C@H]1O[C@@H](CC=O)[C@H](CS(=O)(=O)c2ccccc2)[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40O5SSi/c1-8-19(29-31(6,7)24(3,4)5)16-23-18(2)21(22(28-23)14-15-25)17-30(26,27)20-12-10-9-11-13-20/h9-13,15,18-19,21-23H,8,14,16-17H2,1-7H3/t18-,19-,21-,22+,23-/m1/s1 |
| InChIKey | SBFHHYRWGCOCFL-MRWXXAKJSA-N |
| XLogP | 5.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|