About 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine
3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine (PubChem CID 89182266) has the molecular formula C7H11F4IN2
and a molecular weight of 326.08 g/mol. Its IUPAC name is 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine |
| PubChem CID | 89182266 |
| Molecular Formula | C7H11F4IN2 |
| Molecular Weight | 326.08 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine |
| SMILES | NC1(CF)CCN(C(I)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F4IN2/c8-3-6(13)1-2-14(4-6)5(12)7(9,10)11/h5H,1-4,13H2 |
| InChIKey | MGHDAIWFCNPQFW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine?
The IUPAC name of 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine (CID 89182266) is 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine.
What is the SMILES notation for 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine?
The canonical SMILES for 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine is NC1(CF)CCN(C(I)C(F)(F)F)C1.
What is the InChIKey of 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine?
The InChIKey is MGHDAIWFCNPQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F4IN2/c8-3-6(13)1-2-14(4-6)5(12)7(9,10)11/h5H,1-4,13H2.
What are the key properties of 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine?
3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine has a molecular weight of 326.08 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)-1-(2,2,2-trifluoro-1-iodoethyl)pyrrolidin-3-amine is sourced from PubChem (CID 89182266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).