C18H28O5 — CID 89182449
ethyl (4E,8E)-2-acetyl-10-acetyloxy-4,8-dimethyldeca-4,8-dienoate (PubChem CID 89182449) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethyl (4E,8E)-2-acetyl-10-acetyloxy-4,8-dimethyldeca-4,8-dienoate.
| Compound Name | ethyl (4E,8E)-2-acetyl-10-acetyloxy-4,8-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 89182449 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | ethyl (4E,8E)-2-acetyl-10-acetyloxy-4,8-dimethyldeca-4,8-dienoate |
| SMILES | CCOC(=O)C(C/C(C)=C/CC/C(C)=C/COC(C)=O)C(C)=O |
| InChI | InChI=1S/C18H28O5/c1-6-22-18(21)17(15(4)19)12-14(3)9-7-8-13(2)10-11-23-16(5)20/h9-10,17H,6-8,11-12H2,1-5H3/b13-10+,14-9+ |
| InChIKey | YCJSTQGSQOKWOD-JUCMHCFKSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|