About (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate
(2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate (PubChem CID 89182534) has the molecular formula C14H17NO5
and a molecular weight of 279.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate |
| PubChem CID | 89182534 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate |
| SMILES | O=C(CC1C/C=C\CCCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H17NO5/c16-11-6-4-2-1-3-5-10(11)9-14(19)20-15-12(17)7-8-13(15)18/h1,3,10H,2,4-9H2/b3-1- |
| InChIKey | QPEHUGVVPGMLLF-IWQZZHSRSA-N |
| XLogP | 1.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate (CID 89182534) is (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate is O=C(CC1C/C=C\CCCC1=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate?
The InChIKey is QPEHUGVVPGMLLF-IWQZZHSRSA-N. The full InChI is InChI=1S/C14H17NO5/c16-11-6-4-2-1-3-5-10(11)9-14(19)20-15-12(17)7-8-13(15)18/h1,3,10H,2,4-9H2/b3-1-.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate?
(2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate has a molecular weight of 279.29 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2-[(3E)-8-oxocyclooct-3-en-1-yl]acetate is sourced from PubChem (CID 89182534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).