C18H27N3O4 — CID 89182692
N-[(2S)-3-(dimethylamino)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(hydroxymethyl)cyclopropyl]benzamide (PubChem CID 89182692) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[(2S)-3-(dimethylamino)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(hydroxymethyl)cyclopropyl]benzamide.
| Compound Name | N-[(2S)-3-(dimethylamino)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(hydroxymethyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 89182692 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-[(2S)-3-(dimethylamino)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-(hydroxymethyl)cyclopropyl]benzamide |
| SMILES | CN(C)C(C)(C)[C@H](NC(=O)c1ccc(C2CC2CO)cc1)C(=O)NO |
| InChI | InChI=1S/C18H27N3O4/c1-18(2,21(3)4)15(17(24)20-25)19-16(23)12-7-5-11(6-8-12)14-9-13(14)10-22/h5-8,13-15,22,25H,9-10H2,1-4H3,(H,19,23)(H,20,24)/t13?,14?,15-/m1/s1 |
| InChIKey | LJQHXDXCAGJIRS-YMAMQOFZSA-N |
| XLogP | 0.73 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|