C25H29N5O3S — CID 89182757
tert-butyl 3-[1-(4-ethylanilino)-1-oxopent-4-en-2-yl]sulfanyl-5-pyridin-4-yl-1,2,4-triazole-4-carboxylate (PubChem CID 89182757) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is tert-butyl 3-[1-(4-ethylanilino)-1-oxopent-4-en-2-yl]sulfanyl-5-pyridin-4-yl-1,2,4-triazole-4-carboxylate.
| Compound Name | tert-butyl 3-[1-(4-ethylanilino)-1-oxopent-4-en-2-yl]sulfanyl-5-pyridin-4-yl-1,2,4-triazole-4-carboxylate |
|---|---|
| PubChem CID | 89182757 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | tert-butyl 3-[1-(4-ethylanilino)-1-oxopent-4-en-2-yl]sulfanyl-5-pyridin-4-yl-1,2,4-triazole-4-carboxylate |
| SMILES | C=CCC(Sc1nnc(-c2ccncc2)n1C(=O)OC(C)(C)C)C(=O)Nc1ccc(CC)cc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-6-8-20(22(31)27-19-11-9-17(7-2)10-12-19)34-23-29-28-21(18-13-15-26-16-14-18)30(23)24(32)33-25(3,4)5/h6,9-16,20H,1,7-8H2,2-5H3,(H,27,31) |
| InChIKey | GOXOKBJSMDTNAM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|