C23H30NO7PS — CID 89182778
[2-tert-butyl-6-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-1,3-benzothiazol-4-yl] dihydrogen phosphate (PubChem CID 89182778) has the molecular formula C23H30NO7PS and a molecular weight of 495.53 g/mol. Its IUPAC name is [2-tert-butyl-6-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-1,3-benzothiazol-4-yl] dihydrogen phosphate.
| Compound Name | [2-tert-butyl-6-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-1,3-benzothiazol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 89182778 |
| Molecular Formula | C23H30NO7PS |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [2-tert-butyl-6-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-1,3-benzothiazol-4-yl] dihydrogen phosphate |
| SMILES | COC1(c2cc(OP(=O)(O)O)c3nc(C(C)(C)C)sc3c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C23H30NO7PS/c1-21(2,3)20-24-19-17(29-32(25,26)27)10-16(11-18(19)33-20)23(28-4)22(30-31-23)14-6-12-5-13(8-14)9-15(22)7-12/h10-15H,5-9H2,1-4H3,(H2,25,26,27) |
| InChIKey | JNHLSBJAWRMQFW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|