C40H26N4O — CID 89182993
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylacridin-9-one (PubChem CID 89182993) has the molecular formula C40H26N4O and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylacridin-9-one.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylacridin-9-one |
|---|---|
| PubChem CID | 89182993 |
| Molecular Formula | C40H26N4O |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylacridin-9-one |
| SMILES | O=c1c2ccccc2n(-c2ccccc2)c2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc12 |
| InChI | InChI=1S/C40H26N4O/c45-37-33-21-10-11-22-35(33)44(32-19-8-3-9-20-32)36-24-23-30(26-34(36)37)29-17-12-18-31(25-29)40-42-38(27-13-4-1-5-14-27)41-39(43-40)28-15-6-2-7-16-28/h1-26H |
| InChIKey | DSNDAPJOCIPKQD-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|