C21H16F9NO8S — CID 89183148
[5-[2-(2-methoxyethoxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 89183148) has the molecular formula C21H16F9NO8S and a molecular weight of 613.41 g/mol. Its IUPAC name is [5-[2-(2-methoxyethoxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [5-[2-(2-methoxyethoxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 89183148 |
| Molecular Formula | C21H16F9NO8S |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.05 |
| IUPAC Name | [5-[2-(2-methoxyethoxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COCCOCCOc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2=O |
| InChI | InChI=1S/C21H16F9NO8S/c1-36-5-6-37-7-8-38-12-9-11-3-2-4-13-15(11)14(10-12)17(33)31(16(13)32)39-40(34,35)21(29,30)19(24,25)18(22,23)20(26,27)28/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | PWJYUQLXLRSVDE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|