About piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate
piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate (PubChem CID 89183226) has the molecular formula C19H22FN3O2
and a molecular weight of 343.40 g/mol. Its IUPAC name is piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate |
| PubChem CID | 89183226 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate |
| SMILES | Nc1ccc(-c2ccc(F)cc2)cc1NC(=O)OCC1CCNCC1 |
| InChI | InChI=1S/C19H22FN3O2/c20-16-4-1-14(2-5-16)15-3-6-17(21)18(11-15)23-19(24)25-12-13-7-9-22-10-8-13/h1-6,11,13,22H,7-10,12,21H2,(H,23,24) |
| InChIKey | LWQUSDBILPALIA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate?
The IUPAC name of piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate (CID 89183226) is piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate.
What is the SMILES notation for piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate?
The canonical SMILES for piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate is Nc1ccc(-c2ccc(F)cc2)cc1NC(=O)OCC1CCNCC1.
What is the InChIKey of piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate?
The InChIKey is LWQUSDBILPALIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FN3O2/c20-16-4-1-14(2-5-16)15-3-6-17(21)18(11-15)23-19(24)25-12-13-7-9-22-10-8-13/h1-6,11,13,22H,7-10,12,21H2,(H,23,24).
What are the key properties of piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate?
piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate has a molecular weight of 343.40 g/mol, XLogP of 3.62, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl N-[2-amino-5-(4-fluorophenyl)phenyl]carbamate is sourced from PubChem (CID 89183226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).