C21H21FN4O — CID 89183254
N-[2-amino-5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]phenyl]-4-fluoro-1,3-dihydroisoindole-2-carboxamide (PubChem CID 89183254) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[2-amino-5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]phenyl]-4-fluoro-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[2-amino-5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]phenyl]-4-fluoro-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 89183254 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-[2-amino-5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]phenyl]-4-fluoro-1,3-dihydroisoindole-2-carboxamide |
| SMILES | C=C/C=C(\C=C/N)c1ccc(N)c(NC(=O)N2Cc3cccc(F)c3C2)c1 |
| InChI | InChI=1S/C21H21FN4O/c1-2-4-14(9-10-23)15-7-8-19(24)20(11-15)25-21(27)26-12-16-5-3-6-18(22)17(16)13-26/h2-11H,1,12-13,23-24H2,(H,25,27)/b10-9-,14-4+ |
| InChIKey | JXMSWBFKWPAZBP-WPFBOKFSSA-N |
| XLogP | 4.00 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|