C20H24F3N7O7S — CID 89183560
10-[2-[2-(1,1-dihydroxy-3-oxo-1,2,5-thiadiazolidin-2-yl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 89183560) has the molecular formula C20H24F3N7O7S and a molecular weight of 563.52 g/mol. Its IUPAC name is 10-[2-[2-(1,1-dihydroxy-3-oxo-1,2,5-thiadiazolidin-2-yl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 10-[2-[2-(1,1-dihydroxy-3-oxo-1,2,5-thiadiazolidin-2-yl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 89183560 |
| Molecular Formula | C20H24F3N7O7S |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 10-[2-[2-(1,1-dihydroxy-3-oxo-1,2,5-thiadiazolidin-2-yl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCNCCN3C(=O)CNS3(O)O)c2cc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N7O5S.C2HF3O2/c1-10-7-12-13(8-11(10)2)24(16-15(21-12)17(27)23-18(28)22-16)5-3-19-4-6-25-14(26)9-20-31(25,29)30;3-2(4,5)1(6)7/h7-8,19-20,29-30H,3-6,9H2,1-2H3,(H,23,27,28);(H,6,7) |
| InChIKey | GNTQEQFEKIDARJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 202.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|