About ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol
ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol (PubChem CID 89183778) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol.
Molecular Properties
| Compound Name | ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol |
| PubChem CID | 89183778 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol |
| SMILES | C=COC=C.OCC1(CO)COC1 |
| InChI | InChI=1S/C5H10O3.C4H6O/c6-1-5(2-7)3-8-4-5;1-3-5-4-2/h6-7H,1-4H2;3-4H,1-2H2 |
| InChIKey | BKBYVYMRWYZDSA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol?
The IUPAC name of ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol (CID 89183778) is ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol.
What is the SMILES notation for ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol?
The canonical SMILES for ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol is C=COC=C.OCC1(CO)COC1.
What is the InChIKey of ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol?
The InChIKey is BKBYVYMRWYZDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C4H6O/c6-1-5(2-7)3-8-4-5;1-3-5-4-2/h6-7H,1-4H2;3-4H,1-2H2.
What are the key properties of ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol?
ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol has a molecular weight of 188.22 g/mol, XLogP of 0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;[3-(hydroxymethyl)oxetan-3-yl]methanol is sourced from PubChem (CID 89183778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).