About (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride
(2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride (PubChem CID 89183833) has the molecular formula C14H25Cl2NO3
and a molecular weight of 326.26 g/mol. Its IUPAC name is (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride |
| PubChem CID | 89183833 |
| Molecular Formula | C14H25Cl2NO3 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride |
| SMILES | CC(C)C1CC([C@@H](N)C[C@H](C(=O)Cl)C(C)C)OC1=O.Cl |
| InChI | InChI=1S/C14H24ClNO3.ClH/c1-7(2)9(13(15)17)5-11(16)12-6-10(8(3)4)14(18)19-12;/h7-12H,5-6,16H2,1-4H3;1H/t9-,10?,11-,12?;/m0./s1 |
| InChIKey | KORGIEZORBHYMP-MNGDQHHMSA-N |
| XLogP | 2.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride?
The IUPAC name of (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride (CID 89183833) is (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride.
What is the SMILES notation for (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride?
The canonical SMILES for (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride is CC(C)C1CC([C@@H](N)C[C@H](C(=O)Cl)C(C)C)OC1=O.Cl.
What is the InChIKey of (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride?
The InChIKey is KORGIEZORBHYMP-MNGDQHHMSA-N. The full InChI is InChI=1S/C14H24ClNO3.ClH/c1-7(2)9(13(15)17)5-11(16)12-6-10(8(3)4)14(18)19-12;/h7-12H,5-6,16H2,1-4H3;1H/t9-,10?,11-,12?;/m0./s1.
What are the key properties of (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride?
(2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride has a molecular weight of 326.26 g/mol, XLogP of 2.75, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-amino-4-(5-oxo-4-propan-2-yloxolan-2-yl)-2-propan-2-ylbutanoyl chloride;hydrochloride is sourced from PubChem (CID 89183833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).