C22H20BrN5O3 — CID 89184242
1-[2-[(1R,3S,5R)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indole-3-carboxamide (PubChem CID 89184242) has the molecular formula C22H20BrN5O3 and a molecular weight of 482.34 g/mol. Its IUPAC name is 1-[2-[(1R,3S,5R)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indole-3-carboxamide.
| Compound Name | 1-[2-[(1R,3S,5R)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 89184242 |
| Molecular Formula | C22H20BrN5O3 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 1-[2-[(1R,3S,5R)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indole-3-carboxamide |
| SMILES | NC(=O)c1cn(CC(=O)N2[C@@H]3C[C@@H]3C[C@H]2C(=O)Nc2cccc(Br)n2)c2ccccc12 |
| InChI | InChI=1S/C22H20BrN5O3/c23-18-6-3-7-19(25-18)26-22(31)17-9-12-8-16(12)28(17)20(29)11-27-10-14(21(24)30)13-4-1-2-5-15(13)27/h1-7,10,12,16-17H,8-9,11H2,(H2,24,30)(H,25,26,31)/t12-,16-,17+/m1/s1 |
| InChIKey | UFIYIMOWCVCOJB-JLZZUVOBSA-N |
| XLogP | 2.53 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|