C14H19F3N4O2 — CID 89184416
2-[4-(methylaminomethyl)piperidin-1-yl]-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carbaldehyde (PubChem CID 89184416) has the molecular formula C14H19F3N4O2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-[4-(methylaminomethyl)piperidin-1-yl]-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carbaldehyde.
| Compound Name | 2-[4-(methylaminomethyl)piperidin-1-yl]-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 89184416 |
| Molecular Formula | C14H19F3N4O2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[4-(methylaminomethyl)piperidin-1-yl]-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carbaldehyde |
| SMILES | CNCC1CCN(c2nc(C=O)cc(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H19F3N4O2/c1-18-7-10-2-4-21(5-3-10)13-19-11(8-22)6-12(20-13)23-9-14(15,16)17/h6,8,10,18H,2-5,7,9H2,1H3 |
| InChIKey | FFZVFTLTPGZJMT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|