About (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate
(2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate (PubChem CID 8918501) has the molecular formula C17H13FN2O2S
and a molecular weight of 328.37 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
| PubChem CID | 8918501 |
| Molecular Formula | C17H13FN2O2S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2cccnc2)n1)OCc1ccccc1F |
| InChI | InChI=1S/C17H13FN2O2S/c18-15-6-2-1-4-13(15)10-22-16(21)8-14-11-23-17(20-14)12-5-3-7-19-9-12/h1-7,9,11H,8,10H2 |
| InChIKey | TUDVCTYSTFTRSH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate?
The IUPAC name of (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate (CID 8918501) is (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate?
The canonical SMILES for (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate is O=C(Cc1csc(-c2cccnc2)n1)OCc1ccccc1F.
What is the InChIKey of (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate?
The InChIKey is TUDVCTYSTFTRSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2O2S/c18-15-6-2-1-4-13(15)10-22-16(21)8-14-11-23-17(20-14)12-5-3-7-19-9-12/h1-7,9,11H,8,10H2.
What are the key properties of (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate?
(2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate has a molecular weight of 328.37 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 8918501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).