C18H34O2 — CID 89185131
(2R,4S)-3-butoxy-1-cyclohexyl-2,4-dimethylhex-5-en-1-ol (PubChem CID 89185131) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (2R,4S)-3-butoxy-1-cyclohexyl-2,4-dimethylhex-5-en-1-ol.
| Compound Name | (2R,4S)-3-butoxy-1-cyclohexyl-2,4-dimethylhex-5-en-1-ol |
|---|---|
| PubChem CID | 89185131 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (2R,4S)-3-butoxy-1-cyclohexyl-2,4-dimethylhex-5-en-1-ol |
| SMILES | C=C[C@H](C)C(OCCCC)[C@H](C)C(O)C1CCCCC1 |
| InChI | InChI=1S/C18H34O2/c1-5-7-13-20-18(14(3)6-2)15(4)17(19)16-11-9-8-10-12-16/h6,14-19H,2,5,7-13H2,1,3-4H3/t14-,15+,17?,18?/m0/s1 |
| InChIKey | HSQIGEMWDJGGNK-WPAPPDIDSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|