C8H10O3 — CID 89185218
3-hydroxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 89185218) has the molecular formula C8H10O3 and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-hydroxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | 3-hydroxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 89185218 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-hydroxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(O)C2CC=CCC12 |
| InChI | InChI=1S/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-2,5-7,9H,3-4H2 |
| InChIKey | DVJBXMNLZCXFEU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|