C10H8F4O5S — CID 89185282
1,1,1,2-tetrafluoro-3-oxo-3-phenylmethoxypropane-2-sulfonic acid (PubChem CID 89185282) has the molecular formula C10H8F4O5S and a molecular weight of 316.23 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-oxo-3-phenylmethoxypropane-2-sulfonic acid.
| Compound Name | 1,1,1,2-tetrafluoro-3-oxo-3-phenylmethoxypropane-2-sulfonic acid |
|---|---|
| PubChem CID | 89185282 |
| Molecular Formula | C10H8F4O5S |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-oxo-3-phenylmethoxypropane-2-sulfonic acid |
| SMILES | O=C(OCc1ccccc1)C(F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C10H8F4O5S/c11-9(10(12,13)14,20(16,17)18)8(15)19-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,16,17,18) |
| InChIKey | QQRLOQJBMBHIHJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|