C11H8F6O5S — CID 89185300
1,1,1,3,3,3-hexafluoro-2-phenylmethoxycarbonylpropane-2-sulfonic acid (PubChem CID 89185300) has the molecular formula C11H8F6O5S and a molecular weight of 366.24 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-phenylmethoxycarbonylpropane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-phenylmethoxycarbonylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 89185300 |
| Molecular Formula | C11H8F6O5S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-phenylmethoxycarbonylpropane-2-sulfonic acid |
| SMILES | O=C(OCc1ccccc1)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C11H8F6O5S/c12-10(13,14)9(11(15,16)17,23(19,20)21)8(18)22-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,19,20,21) |
| InChIKey | FYVRKCXBXOMZEA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|